C26H25Cl2FN4O3 — CID 73058290
(NE)-N-[6-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[3H-chromene-2,4'-piperidine]-4-ylidene]hydroxylamine (PubChem CID 73058290) has the molecular formula C26H25Cl2FN4O3 and a molecular weight of 531.42 g/mol. Its IUPAC name is (NE)-N-[6-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[3H-chromene-2,4'-piperidine]-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[6-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[3H-chromene-2,4'-piperidine]-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 73058290 |
| Molecular Formula | C26H25Cl2FN4O3 |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (NE)-N-[6-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]spiro[3H-chromene-2,4'-piperidine]-4-ylidene]hydroxylamine |
| SMILES | C[C@@H](Oc1cc(-c2ccc3c(c2)/C(=N/O)CC2(CCNCC2)O3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H25Cl2FN4O3/c1-14(23-18(27)3-4-19(29)24(23)28)35-22-11-16(13-32-25(22)30)15-2-5-21-17(10-15)20(33-34)12-26(36-21)6-8-31-9-7-26/h2-5,10-11,13-14,31,34H,6-9,12H2,1H3,(H2,30,32)/b33-20+/t14-/m1/s1 |
| InChIKey | HOSUGYZBMNKQSJ-MDSLTPKNSA-N |
| XLogP | 6.00 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|