C23H40N4O+2 — CID 7317068
[1-[[4-(diethylamino)phenyl]methyl]piperidin-1-ium-4-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone (PubChem CID 7317068) has the molecular formula C23H40N4O+2 and a molecular weight of 388.60 g/mol. Its IUPAC name is [1-[[4-(diethylamino)phenyl]methyl]piperidin-1-ium-4-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [1-[[4-(diethylamino)phenyl]methyl]piperidin-1-ium-4-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 7317068 |
| Molecular Formula | C23H40N4O+2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | [1-[[4-(diethylamino)phenyl]methyl]piperidin-1-ium-4-yl]-(4-ethylpiperazin-4-ium-1-yl)methanone |
| SMILES | CCN(CC)c1ccc(C[NH+]2CCC(C(=O)N3CC[NH+](CC)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H38N4O/c1-4-24-15-17-27(18-16-24)23(28)21-11-13-25(14-12-21)19-20-7-9-22(10-8-20)26(5-2)6-3/h7-10,21H,4-6,11-19H2,1-3H3/p+2 |
| InChIKey | SPEQATPJICEGEO-UHFFFAOYSA-P |
| XLogP | 0.07 |
| TPSA | 32.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|