C13H24O3 — CID 73333009
5-methoxy-2,2-dimethyldec-3-yne-1,9-diol (PubChem CID 73333009) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyldec-3-yne-1,9-diol.
| Compound Name | 5-methoxy-2,2-dimethyldec-3-yne-1,9-diol |
|---|---|
| PubChem CID | 73333009 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 5-methoxy-2,2-dimethyldec-3-yne-1,9-diol |
| SMILES | COC(C#CC(C)(C)CO)CCCC(C)O |
| InChI | InChI=1S/C13H24O3/c1-11(15)6-5-7-12(16-4)8-9-13(2,3)10-14/h11-12,14-15H,5-7,10H2,1-4H3 |
| InChIKey | JMZAREJLZQVHTP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|