C14H22N5O4+ — CID 74776513
2,6-bis(2-methoxyethyl)-4-methyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 74776513) has the molecular formula C14H22N5O4+ and a molecular weight of 324.36 g/mol. Its IUPAC name is 2,6-bis(2-methoxyethyl)-4-methyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 2,6-bis(2-methoxyethyl)-4-methyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 74776513 |
| Molecular Formula | C14H22N5O4+ |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2,6-bis(2-methoxyethyl)-4-methyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | COCCN1C(=O)C2C(=NC3=[N+](CCOC)CCN32)N(C)C1=O |
| InChI | InChI=1S/C14H22N5O4/c1-16-11-10(12(20)19(14(16)21)7-9-23-3)18-5-4-17(6-8-22-2)13(18)15-11/h10H,4-9H2,1-3H3/q+1 |
| InChIKey | DSYOEYJYYKFAPY-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|