C28H36F3N5O6 — CID 75073247
methyl 2-[[3-[2-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]hydrazinyl]-4,4,4-trifluorobutanoyl]amino]-3-phenylpropanoate (PubChem CID 75073247) has the molecular formula C28H36F3N5O6 and a molecular weight of 595.62 g/mol. Its IUPAC name is methyl 2-[[3-[2-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]hydrazinyl]-4,4,4-trifluorobutanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[3-[2-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]hydrazinyl]-4,4,4-trifluorobutanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 75073247 |
| Molecular Formula | C28H36F3N5O6 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | methyl 2-[[3-[2-[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]hydrazinyl]-4,4,4-trifluorobutanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CC(NNC(=O)C(N)CCCCNC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H36F3N5O6/c1-41-26(39)22(16-19-10-4-2-5-11-19)34-24(37)17-23(28(29,30)31)35-36-25(38)21(32)14-8-9-15-33-27(40)42-18-20-12-6-3-7-13-20/h2-7,10-13,21-23,35H,8-9,14-18,32H2,1H3,(H,33,40)(H,34,37)(H,36,38) |
| InChIKey | JAWOMNGMDVRBPC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|