C16H19N3O7S2 — CID 75455901
[2-(3,4-diethoxyanilino)-2-oxoethyl] 5-sulfamoyl-1,3-thiazole-4-carboxylate (PubChem CID 75455901) has the molecular formula C16H19N3O7S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 5-sulfamoyl-1,3-thiazole-4-carboxylate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 5-sulfamoyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 75455901 |
| Molecular Formula | C16H19N3O7S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 5-sulfamoyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ncsc2S(N)(=O)=O)cc1OCC |
| InChI | InChI=1S/C16H19N3O7S2/c1-3-24-11-6-5-10(7-12(11)25-4-2)19-13(20)8-26-15(21)14-16(27-9-18-14)28(17,22)23/h5-7,9H,3-4,8H2,1-2H3,(H,19,20)(H2,17,22,23) |
| InChIKey | TXNRKSHCNCIMFT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 146.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |