C15H14ClFN4O2 — CID 75502345
1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 75502345) has the molecular formula C15H14ClFN4O2 and a molecular weight of 336.75 g/mol. Its IUPAC name is 1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 75502345 |
| Molecular Formula | C15H14ClFN4O2 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(Cc2cn(-c3ccc(F)c(Cl)c3)nn2)C1=O |
| InChI | InChI=1S/C15H14ClFN4O2/c1-15(2)6-13(22)20(14(15)23)7-9-8-21(19-18-9)10-3-4-12(17)11(16)5-10/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | IHFXSSZMHLGOKJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|