C42H58O4 — CID 75595906
4-[15-(2,3-dihydroxyphenyl)pentadeca-3,5,7-trien-2-yl]-3-pentadeca-8,10,12-trienylbenzene-1,2-diol (PubChem CID 75595906) has the molecular formula C42H58O4 and a molecular weight of 626.92 g/mol. Its IUPAC name is 4-[15-(2,3-dihydroxyphenyl)pentadeca-3,5,7-trien-2-yl]-3-pentadeca-8,10,12-trienylbenzene-1,2-diol.
| Compound Name | 4-[15-(2,3-dihydroxyphenyl)pentadeca-3,5,7-trien-2-yl]-3-pentadeca-8,10,12-trienylbenzene-1,2-diol |
|---|---|
| PubChem CID | 75595906 |
| Molecular Formula | C42H58O4 |
| Molecular Weight | 626.92 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | 4-[15-(2,3-dihydroxyphenyl)pentadeca-3,5,7-trien-2-yl]-3-pentadeca-8,10,12-trienylbenzene-1,2-diol |
| SMILES | CCC=CC=CC=CCCCCCCCc1c(C(C)C=CC=CC=CCCCCCCCc2cccc(O)c2O)ccc(O)c1O |
| InChI | InChI=1S/C42H58O4/c1-3-4-5-6-7-8-9-10-14-17-20-23-26-31-38-37(33-34-40(44)42(38)46)35(2)28-24-21-18-15-12-11-13-16-19-22-25-29-36-30-27-32-39(43)41(36)45/h4-9,12,15,18,21,24,27-28,30,32-35,43-46H,3,10-11,13-14,16-17,19-20,22-23,25-26,29,31H2,1-2H3 |
| InChIKey | RIAWVQFBXPMMDD-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.92 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|