C13H16N2O5S2 — CID 7569970
(3R)-3-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]oxolan-2-one (PubChem CID 7569970) has the molecular formula C13H16N2O5S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R)-3-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]oxolan-2-one.
| Compound Name | (3R)-3-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 7569970 |
| Molecular Formula | C13H16N2O5S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (3R)-3-[(5-morpholin-4-ylsulfonyl-2-pyridinyl)sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1ccc(S(=O)(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C13H16N2O5S2/c16-13-11(3-6-20-13)21-12-2-1-10(9-14-12)22(17,18)15-4-7-19-8-5-15/h1-2,9,11H,3-8H2/t11-/m1/s1 |
| InChIKey | RJOJHYFRSVOPNY-LLVKDONJSA-N |
| XLogP | 0.51 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |