C13H14Cl3N3O4 — CID 7633897
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 7633897) has the molecular formula C13H14Cl3N3O4 and a molecular weight of 382.63 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7633897 |
| Molecular Formula | C13H14Cl3N3O4 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)OCC(=O)NC[C@H]2CCCO2)c1Cl |
| InChI | InChI=1S/C13H14Cl3N3O4/c14-8-10(17)9(15)12(16)19-11(8)13(21)23-5-7(20)18-4-6-2-1-3-22-6/h6H,1-5H2,(H2,17,19)(H,18,20)/t6-/m1/s1 |
| InChIKey | OFFADQCGZXRCFQ-ZCFIWIBFSA-N |
| XLogP | 2.08 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|