C18H21NO4 — CID 76833123
2-(6-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)isoindole-1,3-dione (PubChem CID 76833123) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(6-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(6-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 76833123 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-(6-ethyl-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)isoindole-1,3-dione |
| SMILES | CCC1CC(N2C(=O)c3ccccc3C2=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C18H21NO4/c1-4-10-9-13(15-14(10)22-18(2,3)23-15)19-16(20)11-7-5-6-8-12(11)17(19)21/h5-8,10,13-15H,4,9H2,1-3H3 |
| InChIKey | IGFUOQLKFVBLOP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|