C62H58N2O5S2 — CID 76853674
prop-2-enyl (2S)-4-[bis[2-(triphenyl-λ4-sulfanyl)ethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate (PubChem CID 76853674) has the molecular formula C62H58N2O5S2 and a molecular weight of 975.29 g/mol. Its IUPAC name is prop-2-enyl (2S)-4-[bis[2-(triphenyl-λ4-sulfanyl)ethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate.
| Compound Name | prop-2-enyl (2S)-4-[bis[2-(triphenyl-λ4-sulfanyl)ethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 76853674 |
| Molecular Formula | C62H58N2O5S2 |
| Molecular Weight | 975.29 g/mol |
| Exact Mass | 974.38 |
| IUPAC Name | prop-2-enyl (2S)-4-[bis[2-(triphenyl-λ4-sulfanyl)ethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
| SMILES | C=CCOC(=O)[C@H](CC(=O)N(CCS(c1ccccc1)(c1ccccc1)c1ccccc1)CCS(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C62H58N2O5S2/c1-2-43-68-61(66)59(63-62(67)69-47-58-56-39-23-21-37-54(56)55-38-22-24-40-57(55)58)46-60(65)64(41-44-70(48-25-9-3-10-26-48,49-27-11-4-12-28-49)50-29-13-5-14-30-50)42-45-71(51-31-15-6-16-32-51,52-33-17-7-18-34-52)53-35-19-8-20-36-53/h2-40,58-59H,1,41-47H2,(H,63,67)/t59-/m0/s1 |
| InChIKey | SUAOAZLBSVEJOF-MNPYLUJASA-N |
| XLogP | 13.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.29 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|