2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid

C6H5NO2 — CID 76974721

IUPAC2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid
SMILES[2H][13c]1[15n]ccc[13c]1[13C](=O)O
InChIInChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/i4+1D,5+1,6+1,7+1
InChIKeyPVNIIMVLHYAWGP-JULLIWLPSA-N
MW128.09 g/mol
LogP0.78
Rot. Bonds1

About 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid

2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid (PubChem CID 76974721) has the molecular formula C6H5NO2 and a molecular weight of 128.09 g/mol. Its IUPAC name is 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid
PubChem CID76974721
Molecular FormulaC6H5NO2
Molecular Weight128.09 g/mol
Exact Mass128.05
IUPAC Name2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid
SMILES[2H][13c]1[15n]ccc[13c]1[13C](=O)O
InChIInChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/i4+1D,5+1,6+1,7+1
InChIKeyPVNIIMVLHYAWGP-JULLIWLPSA-N
XLogP0.78
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.09
LogP ≤ 50.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid?
The IUPAC name of 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid (CID 76974721) is 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid?
The canonical SMILES for 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid is [2H][13c]1[15n]ccc[13c]1[13C](=O)O.
What is the InChIKey of 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid?
The InChIKey is PVNIIMVLHYAWGP-JULLIWLPSA-N. The full InChI is InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/i4+1D,5+1,6+1,7+1.
What are the key properties of 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid?
2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid has a molecular weight of 128.09 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio(2,3-13C2,115N)pyridine-3-carboxylic acid is sourced from PubChem (CID 76974721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).