C12H19N3O2 — CID 79502032
3-(ethylaminomethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione (PubChem CID 79502032) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione.
| Compound Name | 3-(ethylaminomethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione |
|---|---|
| PubChem CID | 79502032 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(ethylaminomethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione |
| SMILES | CCNCC1=NC(=O)C2(CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C12H19N3O2/c1-2-13-8-9-14-10(16)12(11(17)15-9)6-4-3-5-7-12/h13H,2-8H2,1H3,(H,14,15,16,17) |
| InChIKey | CKDFSZQXUUUQFF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|