C11H15ClN2O2 — CID 80655736
3-(1-chloroethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione (PubChem CID 80655736) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-(1-chloroethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione.
| Compound Name | 3-(1-chloroethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione |
|---|---|
| PubChem CID | 80655736 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(1-chloroethyl)-2,4-diazaspiro[5.5]undec-3-ene-1,5-dione |
| SMILES | CC(Cl)C1=NC(=O)C2(CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-7(12)8-13-9(15)11(10(16)14-8)5-3-2-4-6-11/h7H,2-6H2,1H3,(H,13,14,15,16) |
| InChIKey | OZHSKJHRYWUWPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|