C12H16N4O2 — CID 79891169
2-[(4-amino-1,3-benzoxazol-2-yl)amino]-N-propylacetamide (PubChem CID 79891169) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-N-propylacetamide.
| Compound Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 79891169 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C12H16N4O2/c1-2-6-14-10(17)7-15-12-16-11-8(13)4-3-5-9(11)18-12/h3-5H,2,6-7,13H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | SWJCSNSAABRYII-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|