C10H12N2O4 — CID 822290
(4aR,8aS)-6,7-dimethoxy-4a,8a-dihydro-1H-quinazoline-2,4-dione (PubChem CID 822290) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (4aR,8aS)-6,7-dimethoxy-4a,8a-dihydro-1H-quinazoline-2,4-dione.
| Compound Name | (4aR,8aS)-6,7-dimethoxy-4a,8a-dihydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 822290 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (4aR,8aS)-6,7-dimethoxy-4a,8a-dihydro-1H-quinazoline-2,4-dione |
| SMILES | COC1=C[C@@H]2NC(=O)NC(=O)[C@@H]2C=C1OC |
| InChI | InChI=1S/C10H12N2O4/c1-15-7-3-5-6(4-8(7)16-2)11-10(14)12-9(5)13/h3-6H,1-2H3,(H2,11,12,13,14)/t5-,6+/m1/s1 |
| InChIKey | KMDHWKKDYUBWGU-RITPCOANSA-N |
| XLogP | -0.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |