C7H3BrCl2N2O — CID 82233669
7-bromo-4,6-dichloro-1,3-benzoxazol-2-amine (PubChem CID 82233669) has the molecular formula C7H3BrCl2N2O and a molecular weight of 281.92 g/mol. Its IUPAC name is 7-bromo-4,6-dichloro-1,3-benzoxazol-2-amine.
| Compound Name | 7-bromo-4,6-dichloro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 82233669 |
| Molecular Formula | C7H3BrCl2N2O |
| Molecular Weight | 281.92 g/mol |
| Exact Mass | 279.88 |
| IUPAC Name | 7-bromo-4,6-dichloro-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2c(Cl)cc(Cl)c(Br)c2o1 |
| InChI | InChI=1S/C7H3BrCl2N2O/c8-4-2(9)1-3(10)5-6(4)13-7(11)12-5/h1H,(H2,11,12) |
| InChIKey | PXVUFARNZIPWLN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|