C16H12Cl2N3S+ — CID 831013
2-(2,2-dichloroethenyl)-N,3-diphenyl-1,2,4-thiadiazol-2-ium-5-amine (PubChem CID 831013) has the molecular formula C16H12Cl2N3S+ and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-(2,2-dichloroethenyl)-N,3-diphenyl-1,2,4-thiadiazol-2-ium-5-amine.
| Compound Name | 2-(2,2-dichloroethenyl)-N,3-diphenyl-1,2,4-thiadiazol-2-ium-5-amine |
|---|---|
| PubChem CID | 831013 |
| Molecular Formula | C16H12Cl2N3S+ |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-(2,2-dichloroethenyl)-N,3-diphenyl-1,2,4-thiadiazol-2-ium-5-amine |
| SMILES | ClC(Cl)=C[n+]1sc(Nc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H11Cl2N3S/c17-14(18)11-21-15(12-7-3-1-4-8-12)20-16(22-21)19-13-9-5-2-6-10-13/h1-11H/p+1 |
| InChIKey | QHSZDZUDLQOWIE-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|