C13H16N2 — CID 83819294
6-(dimethylamino)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (PubChem CID 83819294) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-(dimethylamino)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | 6-(dimethylamino)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 83819294 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 6-(dimethylamino)-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| SMILES | CN(C)c1ccc2c(c1)CCCC2C#N |
| InChI | InChI=1S/C13H16N2/c1-15(2)12-6-7-13-10(8-12)4-3-5-11(13)9-14/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | YMYFEDZCWMZGPW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|