C18H26N6O — CID 84587077
1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(1-pyridin-2-ylbutyl)urea (PubChem CID 84587077) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(1-pyridin-2-ylbutyl)urea.
| Compound Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(1-pyridin-2-ylbutyl)urea |
|---|---|
| PubChem CID | 84587077 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(1-pyridin-2-ylbutyl)urea |
| SMILES | CCCC(NC(=O)NC1CCCn2nc(CC)nc21)c1ccccn1 |
| InChI | InChI=1S/C18H26N6O/c1-3-8-14(13-9-5-6-11-19-13)20-18(25)21-15-10-7-12-24-17(15)22-16(4-2)23-24/h5-6,9,11,14-15H,3-4,7-8,10,12H2,1-2H3,(H2,20,21,25) |
| InChIKey | WRYLCQAJIDVVNF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |