C12H9IN2O2S — CID 86020360
5-iodo-N-(phenylcarbamothioyl)furan-2-carboxamide (PubChem CID 86020360) has the molecular formula C12H9IN2O2S and a molecular weight of 372.19 g/mol. Its IUPAC name is 5-iodo-N-(phenylcarbamothioyl)furan-2-carboxamide.
| Compound Name | 5-iodo-N-(phenylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 86020360 |
| Molecular Formula | C12H9IN2O2S |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 5-iodo-N-(phenylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1)c1ccc(I)o1 |
| InChI | InChI=1S/C12H9IN2O2S/c13-10-7-6-9(17-10)11(16)15-12(18)14-8-4-2-1-3-5-8/h1-7H,(H2,14,15,16,18) |
| InChIKey | USIHDRQEVCXMMS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|