C16H11ClN2S — CID 86076766
2-(2-chlorophenyl)-4,9-dihydro-[1,3]thiazino[6,5-b]indole (PubChem CID 86076766) has the molecular formula C16H11ClN2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4,9-dihydro-[1,3]thiazino[6,5-b]indole.
| Compound Name | 2-(2-chlorophenyl)-4,9-dihydro-[1,3]thiazino[6,5-b]indole |
|---|---|
| PubChem CID | 86076766 |
| Molecular Formula | C16H11ClN2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(2-chlorophenyl)-4,9-dihydro-[1,3]thiazino[6,5-b]indole |
| SMILES | Clc1ccccc1C1=NCc2c([nH]c3ccccc23)S1 |
| InChI | InChI=1S/C16H11ClN2S/c17-13-7-3-1-6-11(13)15-18-9-12-10-5-2-4-8-14(10)19-16(12)20-15/h1-8,19H,9H2 |
| InChIKey | RHDAYHURUVHDIH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |