C17H22Cl2N4O4S — CID 86279953
2-(4,5-dichloro-2-hydroxyanilino)-1-[3-(4-ethenylsulfonylpiperazin-1-yl)azetidin-1-yl]ethanone (PubChem CID 86279953) has the molecular formula C17H22Cl2N4O4S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-1-[3-(4-ethenylsulfonylpiperazin-1-yl)azetidin-1-yl]ethanone.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[3-(4-ethenylsulfonylpiperazin-1-yl)azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 86279953 |
| Molecular Formula | C17H22Cl2N4O4S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[3-(4-ethenylsulfonylpiperazin-1-yl)azetidin-1-yl]ethanone |
| SMILES | C=CS(=O)(=O)N1CCN(C2CN(C(=O)CNc3cc(Cl)c(Cl)cc3O)C2)CC1 |
| InChI | InChI=1S/C17H22Cl2N4O4S/c1-2-28(26,27)23-5-3-21(4-6-23)12-10-22(11-12)17(25)9-20-15-7-13(18)14(19)8-16(15)24/h2,7-8,12,20,24H,1,3-6,9-11H2 |
| InChIKey | OMLZGRBHPMVYJI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|