C19H18Cl2F4N4O4S — CID 167080306
2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-sulfamoylphenyl)piperidin-4-yl]acetamide (PubChem CID 167080306) has the molecular formula C19H18Cl2F4N4O4S and a molecular weight of 545.34 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-sulfamoylphenyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-sulfamoylphenyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 167080306 |
| Molecular Formula | C19H18Cl2F4N4O4S |
| Molecular Weight | 545.34 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-sulfamoylphenyl)piperidin-4-yl]acetamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1N1CCC(NC(=O)CNc2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C19H18Cl2F4N4O4S/c20-9-5-11(12(30)6-10(9)21)27-7-13(31)28-8-1-3-29(4-2-8)18-16(24)14(22)15(23)17(25)19(18)34(26,32)33/h5-6,8,27,30H,1-4,7H2,(H,28,31)(H2,26,32,33) |
| InChIKey | ZZHYZTJYRGUPCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|