C20H22N2O9S — CID 86302385
[7-methoxy-1-oxo-2-(3,4,5-trimethoxybenzoyl)-3,4-dihydroisoquinolin-6-yl] sulfamate (PubChem CID 86302385) has the molecular formula C20H22N2O9S and a molecular weight of 466.47 g/mol. Its IUPAC name is [7-methoxy-1-oxo-2-(3,4,5-trimethoxybenzoyl)-3,4-dihydroisoquinolin-6-yl] sulfamate.
| Compound Name | [7-methoxy-1-oxo-2-(3,4,5-trimethoxybenzoyl)-3,4-dihydroisoquinolin-6-yl] sulfamate |
|---|---|
| PubChem CID | 86302385 |
| Molecular Formula | C20H22N2O9S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [7-methoxy-1-oxo-2-(3,4,5-trimethoxybenzoyl)-3,4-dihydroisoquinolin-6-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CCN(C(=O)c1cc(OC)c(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C20H22N2O9S/c1-27-14-10-13-11(7-15(14)31-32(21,25)26)5-6-22(20(13)24)19(23)12-8-16(28-2)18(30-4)17(9-12)29-3/h7-10H,5-6H2,1-4H3,(H2,21,25,26) |
| InChIKey | APSGSMKZEXCRQA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|