C6H14NO6S- — CID 86307784
2-[1,3-dihydroxypropan-2-yl(hydroxymethyl)amino]ethanesulfonate (PubChem CID 86307784) has the molecular formula C6H14NO6S- and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[1,3-dihydroxypropan-2-yl(hydroxymethyl)amino]ethanesulfonate.
| Compound Name | 2-[1,3-dihydroxypropan-2-yl(hydroxymethyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 86307784 |
| Molecular Formula | C6H14NO6S- |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[1,3-dihydroxypropan-2-yl(hydroxymethyl)amino]ethanesulfonate |
| SMILES | O=S(=O)([O-])CCN(CO)C(CO)CO |
| InChI | InChI=1S/C6H15NO6S/c8-3-6(4-9)7(5-10)1-2-14(11,12)13/h6,8-10H,1-5H2,(H,11,12,13)/p-1 |
| InChIKey | GQIJAIFTYFZHJE-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|