C25H21BrN2O3 — CID 86598366
methyl 4-[[(Z)-(1-benzylindol-3-yl)methylideneamino]oxymethyl]-2-bromobenzoate (PubChem CID 86598366) has the molecular formula C25H21BrN2O3 and a molecular weight of 477.36 g/mol. Its IUPAC name is methyl 4-[[(Z)-(1-benzylindol-3-yl)methylideneamino]oxymethyl]-2-bromobenzoate.
| Compound Name | methyl 4-[[(Z)-(1-benzylindol-3-yl)methylideneamino]oxymethyl]-2-bromobenzoate |
|---|---|
| PubChem CID | 86598366 |
| Molecular Formula | C25H21BrN2O3 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | methyl 4-[[(Z)-(1-benzylindol-3-yl)methylideneamino]oxymethyl]-2-bromobenzoate |
| SMILES | COC(=O)c1ccc(CO/N=C\c2cn(Cc3ccccc3)c3ccccc23)cc1Br |
| InChI | InChI=1S/C25H21BrN2O3/c1-30-25(29)22-12-11-19(13-23(22)26)17-31-27-14-20-16-28(15-18-7-3-2-4-8-18)24-10-6-5-9-21(20)24/h2-14,16H,15,17H2,1H3/b27-14- |
| InChIKey | OGFFFVQHLBFXMQ-VYYCAZPPSA-N |
| XLogP | 5.79 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|