C23H30F8N2O3S — CID 86685883
2-methyl-N-[1,1,1,3,3-pentafluoro-4-oxo-4-piperidin-1-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide (PubChem CID 86685883) has the molecular formula C23H30F8N2O3S and a molecular weight of 566.56 g/mol. Its IUPAC name is 2-methyl-N-[1,1,1,3,3-pentafluoro-4-oxo-4-piperidin-1-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[1,1,1,3,3-pentafluoro-4-oxo-4-piperidin-1-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 86685883 |
| Molecular Formula | C23H30F8N2O3S |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-methyl-N-[1,1,1,3,3-pentafluoro-4-oxo-4-piperidin-1-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]butan-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(c1ccc(OCCCC(F)(F)F)cc1)(C(F)(F)F)C(F)(F)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H30F8N2O3S/c1-19(2,3)37(35)32-21(23(29,30)31,22(27,28)18(34)33-13-5-4-6-14-33)16-8-10-17(11-9-16)36-15-7-12-20(24,25)26/h8-11,32H,4-7,12-15H2,1-3H3 |
| InChIKey | IDTLMNDUYKHSQZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|