C20H27F3N4O4S2 — CID 86727132
[3-methoxy-4-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 86727132) has the molecular formula C20H27F3N4O4S2 and a molecular weight of 508.59 g/mol. Its IUPAC name is [3-methoxy-4-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-methoxy-4-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86727132 |
| Molecular Formula | C20H27F3N4O4S2 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | [3-methoxy-4-[5-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1nnc(N(C)C2CC(C)(C)NC(C)(C)C2)s1 |
| InChI | InChI=1S/C20H27F3N4O4S2/c1-18(2)10-12(11-19(3,4)26-18)27(5)17-25-24-16(32-17)14-8-7-13(9-15(14)30-6)31-33(28,29)20(21,22)23/h7-9,12,26H,10-11H2,1-6H3 |
| InChIKey | VZHCUIZYLDISTF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|