C28H37N3O4S — CID 86750096
5-[3-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 86750096) has the molecular formula C28H37N3O4S and a molecular weight of 511.69 g/mol. Its IUPAC name is 5-[3-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[3-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 86750096 |
| Molecular Formula | C28H37N3O4S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 5-[3-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=C2C=C(C=Cc3ccc(N(CCO)CCO)cc3)CC(C)(C)C2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C28H37N3O4S/c1-5-30-25(34)24(26(35)31(6-2)27(30)36)22-17-21(18-28(3,4)19-22)8-7-20-9-11-23(12-10-20)29(13-15-32)14-16-33/h7-12,17,32-33H,5-6,13-16,18-19H2,1-4H3 |
| InChIKey | DKSXZROEKLBKJC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|