C18H19N5O3 — CID 86807540
N-[3-[(2-oxo-1,3-diazinan-1-yl)carbamoylamino]phenyl]benzamide (PubChem CID 86807540) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[3-[(2-oxo-1,3-diazinan-1-yl)carbamoylamino]phenyl]benzamide.
| Compound Name | N-[3-[(2-oxo-1,3-diazinan-1-yl)carbamoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 86807540 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[3-[(2-oxo-1,3-diazinan-1-yl)carbamoylamino]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccccc2)c1)NN1CCCNC1=O |
| InChI | InChI=1S/C18H19N5O3/c24-16(13-6-2-1-3-7-13)20-14-8-4-9-15(12-14)21-17(25)22-23-11-5-10-19-18(23)26/h1-4,6-9,12H,5,10-11H2,(H,19,26)(H,20,24)(H2,21,22,25) |
| InChIKey | YLOREBZENUAUDT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |