C23H27FN2O3S — CID 86843807
2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(2-phenyloxan-3-yl)methyl]propanamide (PubChem CID 86843807) has the molecular formula C23H27FN2O3S and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(2-phenyloxan-3-yl)methyl]propanamide.
| Compound Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(2-phenyloxan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 86843807 |
| Molecular Formula | C23H27FN2O3S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyl-N-[(2-phenyloxan-3-yl)methyl]propanamide |
| SMILES | CC(SCC(=O)Nc1ccc(F)cc1)C(=O)NCC1CCCOC1c1ccccc1 |
| InChI | InChI=1S/C23H27FN2O3S/c1-16(30-15-21(27)26-20-11-9-19(24)10-12-20)23(28)25-14-18-8-5-13-29-22(18)17-6-3-2-4-7-17/h2-4,6-7,9-12,16,18,22H,5,8,13-15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | SRLLECSHOFZUCR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |