C19H26F3N3O3 — CID 86886702
2-acetamido-N-[4-(2,6-dimethylmorpholin-4-yl)-3-(trifluoromethyl)phenyl]-2-methylpropanamide (PubChem CID 86886702) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is 2-acetamido-N-[4-(2,6-dimethylmorpholin-4-yl)-3-(trifluoromethyl)phenyl]-2-methylpropanamide.
| Compound Name | 2-acetamido-N-[4-(2,6-dimethylmorpholin-4-yl)-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 86886702 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-acetamido-N-[4-(2,6-dimethylmorpholin-4-yl)-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
| SMILES | CC(=O)NC(C)(C)C(=O)Nc1ccc(N2CC(C)OC(C)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H26F3N3O3/c1-11-9-25(10-12(2)28-11)16-7-6-14(8-15(16)19(20,21)22)23-17(27)18(4,5)24-13(3)26/h6-8,11-12H,9-10H2,1-5H3,(H,23,27)(H,24,26) |
| InChIKey | LCDLHMRTKPWYAC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|