C34H38N2O5 — CID 87056950
(Z)-but-2-enedioic acid;(E)-N-[4-(dimethylamino)-1,4-diphenylcyclohexyl]-N-methyl-3-phenylprop-2-enamide (PubChem CID 87056950) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-N-[4-(dimethylamino)-1,4-diphenylcyclohexyl]-N-methyl-3-phenylprop-2-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(E)-N-[4-(dimethylamino)-1,4-diphenylcyclohexyl]-N-methyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 87056950 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-N-[4-(dimethylamino)-1,4-diphenylcyclohexyl]-N-methyl-3-phenylprop-2-enamide |
| SMILES | CN(C)C1(c2ccccc2)CCC(c2ccccc2)(N(C)C(=O)/C=C/c2ccccc2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C30H34N2O.C4H4O4/c1-31(2)29(26-15-9-5-10-16-26)21-23-30(24-22-29,27-17-11-6-12-18-27)32(3)28(33)20-19-25-13-7-4-8-14-25;5-3(6)1-2-4(7)8/h4-20H,21-24H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b20-19+;2-1- |
| InChIKey | CXXHBQPWLYGSPX-ZPEIAHGDSA-N |
| XLogP | 5.80 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|