C47H39Br2N3O8 — CID 87103562
5-[5-[3-[[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]amino]phenoxy]pentylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 87103562) has the molecular formula C47H39Br2N3O8 and a molecular weight of 933.65 g/mol. Its IUPAC name is 5-[5-[3-[[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]amino]phenoxy]pentylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[5-[3-[[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]amino]phenoxy]pentylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 87103562 |
| Molecular Formula | C47H39Br2N3O8 |
| Molecular Weight | 933.65 g/mol |
| Exact Mass | 931.11 |
| IUPAC Name | 5-[5-[3-[[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]amino]phenoxy]pentylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(NCCCCCOc1cccc(NCC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)c1)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C47H39Br2N3O8/c48-28-8-15-41-38(20-28)39-21-29(49)9-16-42(39)52(41)26-33(55)25-51-30-5-4-6-34(22-30)59-18-3-1-2-17-50-46(56)27-7-12-35(40(19-27)47(57)58)45-36-13-10-31(53)23-43(36)60-44-24-32(54)11-14-37(44)45/h4-16,19-24,33,51,53,55H,1-3,17-18,25-26H2,(H,50,56)(H,57,58) |
| InChIKey | KANUBOWKQNWTKO-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.65 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|