About 5-ethynylquinoxaline
5-ethynylquinoxaline (PubChem CID 87150126) has the molecular formula C10H6N2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-ethynylquinoxaline.
Molecular Properties
| Compound Name | 5-ethynylquinoxaline |
| PubChem CID | 87150126 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 5-ethynylquinoxaline |
| SMILES | C#Cc1cccc2nccnc12 |
| InChI | InChI=1S/C10H6N2/c1-2-8-4-3-5-9-10(8)12-7-6-11-9/h1,3-7H |
| InChIKey | OWACAKSTKOEANZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynylquinoxaline?
The IUPAC name of 5-ethynylquinoxaline (CID 87150126) is 5-ethynylquinoxaline.
What is the SMILES notation for 5-ethynylquinoxaline?
The canonical SMILES for 5-ethynylquinoxaline is C#Cc1cccc2nccnc12.
What is the InChIKey of 5-ethynylquinoxaline?
The InChIKey is OWACAKSTKOEANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2/c1-2-8-4-3-5-9-10(8)12-7-6-11-9/h1,3-7H.
What are the key properties of 5-ethynylquinoxaline?
5-ethynylquinoxaline has a molecular weight of 154.17 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynylquinoxaline is sourced from PubChem (CID 87150126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).