C60H81N3O9 — CID 87200978
1,3,5-tris[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-ynoxy]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 87200978) has the molecular formula C60H81N3O9 and a molecular weight of 988.32 g/mol. Its IUPAC name is 1,3,5-tris[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-ynoxy]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-ynoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87200978 |
| Molecular Formula | C60H81N3O9 |
| Molecular Weight | 988.32 g/mol |
| Exact Mass | 987.60 |
| IUPAC Name | 1,3,5-tris[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-ynoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(C)(C)c1cc(CC#COCCn2c(=O)n(CCOC#CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(=O)n(CCOC#CCc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C60H81N3O9/c1-55(2,3)43-34-40(35-44(49(43)64)56(4,5)6)22-19-28-70-31-25-61-52(67)62(26-32-71-29-20-23-41-36-45(57(7,8)9)50(65)46(37-41)58(10,11)12)54(69)63(53(61)68)27-33-72-30-21-24-42-38-47(59(13,14)15)51(66)48(39-42)60(16,17)18/h34-39,64-66H,22-27,31-33H2,1-18H3 |
| InChIKey | HJCHVYVQSPAXKL-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.32 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|