C19H20F3NO4 — CID 87355222
(2S,3S)-5,5,5-trifluoro-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide (PubChem CID 87355222) has the molecular formula C19H20F3NO4 and a molecular weight of 383.37 g/mol. Its IUPAC name is (2S,3S)-5,5,5-trifluoro-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide.
| Compound Name | (2S,3S)-5,5,5-trifluoro-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
|---|---|
| PubChem CID | 87355222 |
| Molecular Formula | C19H20F3NO4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2S,3S)-5,5,5-trifluoro-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)NO)[C@@H](O)CC(F)(F)F |
| InChI | InChI=1S/C19H20F3NO4/c1-18(17(25)23-26,16(24)11-19(20,21)22)27-12-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,16,24,26H,11-12H2,1H3,(H,23,25)/t16-,18-/m0/s1 |
| InChIKey | JCZKNQBVKSRKGG-WMZOPIPTSA-N |
| XLogP | 3.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|