C12H23NO5Si — CID 87395634
(2S,4R)-4-hydroxy-2-methoxycarbonyl-1-(2-trimethylsilylethyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 87395634) has the molecular formula C12H23NO5Si and a molecular weight of 289.40 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-2-methoxycarbonyl-1-(2-trimethylsilylethyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2S,4R)-4-hydroxy-2-methoxycarbonyl-1-(2-trimethylsilylethyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87395634 |
| Molecular Formula | C12H23NO5Si |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2S,4R)-4-hydroxy-2-methoxycarbonyl-1-(2-trimethylsilylethyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O)C[N+]1(CC[Si](C)(C)C)C(=O)[O-] |
| InChI | InChI=1S/C12H23NO5Si/c1-18-11(15)10-7-9(14)8-13(10,12(16)17)5-6-19(2,3)4/h9-10,14H,5-8H2,1-4H3/t9-,10+,13?/m1/s1 |
| InChIKey | FGZFLQZJKBJBDE-GDVCOKDOSA-N |
| XLogP | -0.21 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|