C8H22N2O8P2 — CID 87466801
N,N'-bis(prop-2-enyl)ethane-1,2-diamine;phosphoric acid (PubChem CID 87466801) has the molecular formula C8H22N2O8P2 and a molecular weight of 336.22 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)ethane-1,2-diamine;phosphoric acid.
| Compound Name | N,N'-bis(prop-2-enyl)ethane-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 87466801 |
| Molecular Formula | C8H22N2O8P2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N,N'-bis(prop-2-enyl)ethane-1,2-diamine;phosphoric acid |
| SMILES | C=CCNCCNCC=C.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C8H16N2.2H3O4P/c1-3-5-9-7-8-10-6-4-2;2*1-5(2,3)4/h3-4,9-10H,1-2,5-8H2;2*(H3,1,2,3,4) |
| InChIKey | BYVLKBHHFKVPGF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|