C7H5NO4 — CID 87485410
(5-hydroxy-6-nitrocyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 87485410) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is (5-hydroxy-6-nitrocyclohexa-2,4-dien-1-ylidene)methanone.
| Compound Name | (5-hydroxy-6-nitrocyclohexa-2,4-dien-1-ylidene)methanone |
|---|---|
| PubChem CID | 87485410 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | (5-hydroxy-6-nitrocyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | O=C=C1C=CC=C(O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO4/c9-4-5-2-1-3-6(10)7(5)8(11)12/h1-3,7,10H |
| InChIKey | NBLDMKATQVWJPB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|