C8H7NO3 — CID 172681979
(6-isocyanatocyclohexa-2,4-dien-1-ylidene)methanone;hydrate (PubChem CID 172681979) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is (6-isocyanatocyclohexa-2,4-dien-1-ylidene)methanone;hydrate.
| Compound Name | (6-isocyanatocyclohexa-2,4-dien-1-ylidene)methanone;hydrate |
|---|---|
| PubChem CID | 172681979 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | (6-isocyanatocyclohexa-2,4-dien-1-ylidene)methanone;hydrate |
| SMILES | O.O=C=NC1C=CC=CC1=C=O |
| InChI | InChI=1S/C8H5NO2.H2O/c10-5-7-3-1-2-4-8(7)9-6-11;/h1-4,8H;1H2 |
| InChIKey | XHQUMAGBAKQZOZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|