C17H16O7S — CID 87501433
4,5-dihydroxy-3-(4-methylphenyl)sulfonyloxy-2-prop-2-enylbenzoic acid (PubChem CID 87501433) has the molecular formula C17H16O7S and a molecular weight of 364.38 g/mol. Its IUPAC name is 4,5-dihydroxy-3-(4-methylphenyl)sulfonyloxy-2-prop-2-enylbenzoic acid.
| Compound Name | 4,5-dihydroxy-3-(4-methylphenyl)sulfonyloxy-2-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 87501433 |
| Molecular Formula | C17H16O7S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4,5-dihydroxy-3-(4-methylphenyl)sulfonyloxy-2-prop-2-enylbenzoic acid |
| SMILES | C=CCc1c(C(=O)O)cc(O)c(O)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H16O7S/c1-3-4-12-13(17(20)21)9-14(18)15(19)16(12)24-25(22,23)11-7-5-10(2)6-8-11/h3,5-9,18-19H,1,4H2,2H3,(H,20,21) |
| InChIKey | FHZKODNMBUKOCG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|