About 10-methyltetradecan-2-ol;sulfuric acid
10-methyltetradecan-2-ol;sulfuric acid (PubChem CID 87592713) has the molecular formula C15H34O5S
and a molecular weight of 326.50 g/mol. Its IUPAC name is 10-methyltetradecan-2-ol;sulfuric acid.
Molecular Properties
| Compound Name | 10-methyltetradecan-2-ol;sulfuric acid |
| PubChem CID | 87592713 |
| Molecular Formula | C15H34O5S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 10-methyltetradecan-2-ol;sulfuric acid |
| SMILES | CCCCC(C)CCCCCCCC(C)O.O=S(=O)(O)O |
| InChI | InChI=1S/C15H32O.H2O4S/c1-4-5-11-14(2)12-9-7-6-8-10-13-15(3)16;1-5(2,3)4/h14-16H,4-13H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | RVFFKLIQGCBDMW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 10-methyltetradecan-2-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyltetradecan-2-ol;sulfuric acid?
The IUPAC name of 10-methyltetradecan-2-ol;sulfuric acid (CID 87592713) is 10-methyltetradecan-2-ol;sulfuric acid.
What is the SMILES notation for 10-methyltetradecan-2-ol;sulfuric acid?
The canonical SMILES for 10-methyltetradecan-2-ol;sulfuric acid is CCCCC(C)CCCCCCCC(C)O.O=S(=O)(O)O.
What is the InChIKey of 10-methyltetradecan-2-ol;sulfuric acid?
The InChIKey is RVFFKLIQGCBDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O.H2O4S/c1-4-5-11-14(2)12-9-7-6-8-10-13-15(3)16;1-5(2,3)4/h14-16H,4-13H2,1-3H3;(H2,1,2,3,4).
What are the key properties of 10-methyltetradecan-2-ol;sulfuric acid?
10-methyltetradecan-2-ol;sulfuric acid has a molecular weight of 326.50 g/mol, XLogP of 4.27, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyltetradecan-2-ol;sulfuric acid is sourced from PubChem (CID 87592713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).