C13H20N2O5 — CID 87631678
(2,5-dioxopyrrolidin-1-yl) 1-hydroxy-2,2,3,5-tetramethylpyrrolidine-3-carboxylate (PubChem CID 87631678) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-hydroxy-2,2,3,5-tetramethylpyrrolidine-3-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-hydroxy-2,2,3,5-tetramethylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 87631678 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-hydroxy-2,2,3,5-tetramethylpyrrolidine-3-carboxylate |
| SMILES | CC1CC(C)(C(=O)ON2C(=O)CCC2=O)C(C)(C)N1O |
| InChI | InChI=1S/C13H20N2O5/c1-8-7-13(4,12(2,3)15(8)19)11(18)20-14-9(16)5-6-10(14)17/h8,19H,5-7H2,1-4H3 |
| InChIKey | YCVNDEVHEOCGNF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|