C25H29ClF2N4O7S — CID 87646863
(2S)-2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-hydroxyamino]-3-[1-(morpholine-4-carbonyl)piperidin-4-yl]propanamide (PubChem CID 87646863) has the molecular formula C25H29ClF2N4O7S and a molecular weight of 603.04 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-hydroxyamino]-3-[1-(morpholine-4-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | (2S)-2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-hydroxyamino]-3-[1-(morpholine-4-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 87646863 |
| Molecular Formula | C25H29ClF2N4O7S |
| Molecular Weight | 603.04 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenoxy)-3,5-difluorophenyl]sulfonyl-hydroxyamino]-3-[1-(morpholine-4-carbonyl)piperidin-4-yl]propanamide |
| SMILES | NC(=O)[C@H](CC1CCN(C(=O)N2CCOCC2)CC1)N(O)S(=O)(=O)c1cc(F)c(Oc2ccc(Cl)cc2)c(F)c1 |
| InChI | InChI=1S/C25H29ClF2N4O7S/c26-17-1-3-18(4-2-17)39-23-20(27)14-19(15-21(23)28)40(36,37)32(35)22(24(29)33)13-16-5-7-30(8-6-16)25(34)31-9-11-38-12-10-31/h1-4,14-16,22,35H,5-13H2,(H2,29,33)/t22-/m0/s1 |
| InChIKey | JCQYSCAJRXRUPI-QFIPXVFZSA-N |
| XLogP | 3.20 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.04 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|