C23H25N3O3S — CID 87650937
[2,2-dimethyl-3-(2-methylimidazo[4,5-c]quinolin-1-yl)propyl] 4-methylbenzenesulfonate (PubChem CID 87650937) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylimidazo[4,5-c]quinolin-1-yl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-dimethyl-3-(2-methylimidazo[4,5-c]quinolin-1-yl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87650937 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylimidazo[4,5-c]quinolin-1-yl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)Cn2c(C)nc3cnc4ccccc4c32)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-16-9-11-18(12-10-16)30(27,28)29-15-23(3,4)14-26-17(2)25-21-13-24-20-8-6-5-7-19(20)22(21)26/h5-13H,14-15H2,1-4H3 |
| InChIKey | LNLYFYGKBNKMKQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|