C17H19ClN4O9S — CID 87667306
4-chloro-2-(furan-2-ylmethylamino)-3-[2-[[(2S)-2-nitrooxypropyl]amino]-2-oxoethyl]-5-sulfamoylbenzoic acid (PubChem CID 87667306) has the molecular formula C17H19ClN4O9S and a molecular weight of 490.88 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-3-[2-[[(2S)-2-nitrooxypropyl]amino]-2-oxoethyl]-5-sulfamoylbenzoic acid.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-3-[2-[[(2S)-2-nitrooxypropyl]amino]-2-oxoethyl]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 87667306 |
| Molecular Formula | C17H19ClN4O9S |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-3-[2-[[(2S)-2-nitrooxypropyl]amino]-2-oxoethyl]-5-sulfamoylbenzoic acid |
| SMILES | C[C@@H](CNC(=O)Cc1c(Cl)c(S(N)(=O)=O)cc(C(=O)O)c1NCc1ccco1)O[N+](=O)[O-] |
| InChI | InChI=1S/C17H19ClN4O9S/c1-9(31-22(26)27)7-20-14(23)6-11-15(18)13(32(19,28)29)5-12(17(24)25)16(11)21-8-10-3-2-4-30-10/h2-5,9,21H,6-8H2,1H3,(H,20,23)(H,24,25)(H2,19,28,29)/t9-/m0/s1 |
| InChIKey | BDSIFECXDWXYPI-VIFPVBQESA-N |
| XLogP | 1.15 |
| TPSA | 204.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|