C30H41ClN2O4 — CID 87732297
2-(3-aminocyclopentyl)-3-[1-[3-chloro-2-(2-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde (PubChem CID 87732297) has the molecular formula C30H41ClN2O4 and a molecular weight of 529.12 g/mol. Its IUPAC name is 2-(3-aminocyclopentyl)-3-[1-[3-chloro-2-(2-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde.
| Compound Name | 2-(3-aminocyclopentyl)-3-[1-[3-chloro-2-(2-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 87732297 |
| Molecular Formula | C30H41ClN2O4 |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 2-(3-aminocyclopentyl)-3-[1-[3-chloro-2-(2-methylphenoxy)phenyl]-1-hydroxy-5-methoxypentyl]piperidine-1-carbaldehyde |
| SMILES | COCCCCC(O)(c1cccc(Cl)c1Oc1ccccc1C)C1CCCN(C=O)C1C1CCC(N)C1 |
| InChI | InChI=1S/C30H41ClN2O4/c1-21-9-3-4-13-27(21)37-29-25(10-7-12-26(29)31)30(35,16-5-6-18-36-2)24-11-8-17-33(20-34)28(24)22-14-15-23(32)19-22/h3-4,7,9-10,12-13,20,22-24,28,35H,5-6,8,11,14-19,32H2,1-2H3 |
| InChIKey | LJAYQCOAYDBWJE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|